C22H23N3O5S — CID 55617154
4-(furan-2-ylmethylsulfamoyl)-N-[3-(2-methylpropanoylamino)phenyl]benzamide (PubChem CID 55617154) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfamoyl)-N-[3-(2-methylpropanoylamino)phenyl]benzamide.
| Compound Name | 4-(furan-2-ylmethylsulfamoyl)-N-[3-(2-methylpropanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 55617154 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-(furan-2-ylmethylsulfamoyl)-N-[3-(2-methylpropanoylamino)phenyl]benzamide |
| SMILES | CC(C)C(=O)Nc1cccc(NC(=O)c2ccc(S(=O)(=O)NCc3ccco3)cc2)c1 |
| InChI | InChI=1S/C22H23N3O5S/c1-15(2)21(26)24-17-5-3-6-18(13-17)25-22(27)16-8-10-20(11-9-16)31(28,29)23-14-19-7-4-12-30-19/h3-13,15,23H,14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | CSIKKRGOYNQTEV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |