C21H21N3O6S2 — CID 24584102
N-[3-(cyclopropylsulfamoyl)phenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 24584102) has the molecular formula C21H21N3O6S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)phenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)phenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24584102 |
| Molecular Formula | C21H21N3O6S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)phenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2CC2)c1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H21N3O6S2/c25-21(23-17-3-1-5-20(13-17)32(28,29)24-16-8-9-16)15-6-10-19(11-7-15)31(26,27)22-14-18-4-2-12-30-18/h1-7,10-13,16,22,24H,8-9,14H2,(H,23,25) |
| InChIKey | QJFDIGJASDZUET-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |