C19H18N2O5S — CID 86852545
2-(furan-2-yl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 86852545) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(furan-2-yl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86852545 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-(furan-2-yl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NCc2ccco2)c1)C1CC1c1ccco1 |
| InChI | InChI=1S/C19H18N2O5S/c22-19(17-11-16(17)18-7-3-9-26-18)21-13-4-1-6-15(10-13)27(23,24)20-12-14-5-2-8-25-14/h1-10,16-17,20H,11-12H2,(H,21,22) |
| InChIKey | PRVOHSWSZQSCIS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |