C19H16Cl2N2O4S — CID 34858380
2-(3,4-dichlorophenyl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 34858380) has the molecular formula C19H16Cl2N2O4S and a molecular weight of 439.32 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 34858380 |
| Molecular Formula | C19H16Cl2N2O4S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)Nc1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C19H16Cl2N2O4S/c20-17-7-6-13(9-18(17)21)10-19(24)23-14-3-1-5-16(11-14)28(25,26)22-12-15-4-2-8-27-15/h1-9,11,22H,10,12H2,(H,23,24) |
| InChIKey | WZSWVRCZIJTDHB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |