C19H17ClN2O5S2 — CID 17494727
4-(5-chlorothiophen-2-yl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-4-oxobutanamide (PubChem CID 17494727) has the molecular formula C19H17ClN2O5S2 and a molecular weight of 452.94 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-4-oxobutanamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 17494727 |
| Molecular Formula | C19H17ClN2O5S2 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)s1)Nc1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C19H17ClN2O5S2/c20-18-8-7-17(28-18)16(23)6-9-19(24)22-13-3-1-5-15(11-13)29(25,26)21-12-14-4-2-10-27-14/h1-5,7-8,10-11,21H,6,9,12H2,(H,22,24) |
| InChIKey | GZAIWFCKUMBJKP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |