C19H17ClN2O5S — CID 26590215
2-(2-chlorophenoxy)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 26590215) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 26590215 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)Nc1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C19H17ClN2O5S/c20-17-8-1-2-9-18(17)27-13-19(23)22-14-5-3-7-16(11-14)28(24,25)21-12-15-6-4-10-26-15/h1-11,21H,12-13H2,(H,22,23) |
| InChIKey | FHQUPLNVQDMGBM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |