C16H20N2O4S — CID 51154986
N-[3-(furan-2-ylmethylsulfamoyl)phenyl]pentanamide (PubChem CID 51154986) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethylsulfamoyl)phenyl]pentanamide.
| Compound Name | N-[3-(furan-2-ylmethylsulfamoyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 51154986 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[3-(furan-2-ylmethylsulfamoyl)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C16H20N2O4S/c1-2-3-9-16(19)18-13-6-4-8-15(11-13)23(20,21)17-12-14-7-5-10-22-14/h4-8,10-11,17H,2-3,9,12H2,1H3,(H,18,19) |
| InChIKey | WGEQKKRQQDVAGC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |