C23H26N4O5S — CID 56516173
3-[[benzyl(methyl)carbamoyl]amino]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]propanamide (PubChem CID 56516173) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 56516173 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]propanamide |
| SMILES | CN(Cc1ccccc1)C(=O)NCCC(=O)Nc1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C23H26N4O5S/c1-27(17-18-7-3-2-4-8-18)23(29)24-13-12-22(28)26-19-9-5-11-21(15-19)33(30,31)25-16-20-10-6-14-32-20/h2-11,14-15,25H,12-13,16-17H2,1H3,(H,24,29)(H,26,28) |
| InChIKey | IDSVWEQADZYBTQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |