C16H20N4O5S — CID 119465293
N-[3-[3-(2-aminoethylsulfamoyl)anilino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 119465293) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[3-[3-(2-aminoethylsulfamoyl)anilino]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[3-(2-aminoethylsulfamoyl)anilino]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119465293 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[3-[3-(2-aminoethylsulfamoyl)anilino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | NCCNS(=O)(=O)c1cccc(NC(=O)CCNC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C16H20N4O5S/c17-7-9-19-26(23,24)13-4-1-3-12(11-13)20-15(21)6-8-18-16(22)14-5-2-10-25-14/h1-5,10-11,19H,6-9,17H2,(H,18,22)(H,20,21) |
| InChIKey | VFMLGWHSZYYXHS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |