C22H22N4O6S — CID 26826496
N-[3-[2-[3-(benzylsulfamoyl)benzoyl]hydrazinyl]-3-oxopropyl]furan-2-carboxamide (PubChem CID 26826496) has the molecular formula C22H22N4O6S and a molecular weight of 470.51 g/mol. Its IUPAC name is N-[3-[2-[3-(benzylsulfamoyl)benzoyl]hydrazinyl]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[3-(benzylsulfamoyl)benzoyl]hydrazinyl]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26826496 |
| Molecular Formula | C22H22N4O6S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[3-[2-[3-(benzylsulfamoyl)benzoyl]hydrazinyl]-3-oxopropyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)NNC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N4O6S/c27-20(11-12-23-22(29)19-10-5-13-32-19)25-26-21(28)17-8-4-9-18(14-17)33(30,31)24-15-16-6-2-1-3-7-16/h1-10,13-14,24H,11-12,15H2,(H,23,29)(H,25,27)(H,26,28) |
| InChIKey | CASKRYSIXRZKBS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|