C23H21FN4O5S — CID 27690298
N-[2-[2-[3-(benzylsulfamoyl)benzoyl]hydrazinyl]-2-oxoethyl]-4-fluorobenzamide (PubChem CID 27690298) has the molecular formula C23H21FN4O5S and a molecular weight of 484.51 g/mol. Its IUPAC name is N-[2-[2-[3-(benzylsulfamoyl)benzoyl]hydrazinyl]-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[2-[3-(benzylsulfamoyl)benzoyl]hydrazinyl]-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 27690298 |
| Molecular Formula | C23H21FN4O5S |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | N-[2-[2-[3-(benzylsulfamoyl)benzoyl]hydrazinyl]-2-oxoethyl]-4-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)NNC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H21FN4O5S/c24-19-11-9-17(10-12-19)22(30)25-15-21(29)27-28-23(31)18-7-4-8-20(13-18)34(32,33)26-14-16-5-2-1-3-6-16/h1-13,26H,14-15H2,(H,25,30)(H,27,29)(H,28,31) |
| InChIKey | SBNJDSWUKKLSCM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|