C23H20FN3O4S — CID 26826500
N-benzyl-3-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 26826500) has the molecular formula C23H20FN3O4S and a molecular weight of 453.50 g/mol. Its IUPAC name is N-benzyl-3-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26826500 |
| Molecular Formula | C23H20FN3O4S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-benzyl-3-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | O=C(/C=C/c1ccccc1F)NNC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H20FN3O4S/c24-21-12-5-4-9-18(21)13-14-22(28)26-27-23(29)19-10-6-11-20(15-19)32(30,31)25-16-17-7-2-1-3-8-17/h1-15,25H,16H2,(H,26,28)(H,27,29)/b14-13+ |
| InChIKey | FAOAVWGCFALWMZ-BUHFOSPRSA-N |
| XLogP | 2.78 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|