C23H18FN3O4S2 — CID 43016972
N-benzyl-3-[[(4-fluoro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 43016972) has the molecular formula C23H18FN3O4S2 and a molecular weight of 483.55 g/mol. Its IUPAC name is N-benzyl-3-[[(4-fluoro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[[(4-fluoro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43016972 |
| Molecular Formula | C23H18FN3O4S2 |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | N-benzyl-3-[[(4-fluoro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cc2c(F)cccc2s1)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H18FN3O4S2/c24-19-10-5-11-20-18(19)13-21(32-20)23(29)27-26-22(28)16-8-4-9-17(12-16)33(30,31)25-14-15-6-2-1-3-7-15/h1-13,25H,14H2,(H,26,28)(H,27,29) |
| InChIKey | SVNQOLAUAWKWFR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|