C26H23N3O4S — CID 27690215
N-benzyl-3-[[(2-naphthalen-2-ylacetyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 27690215) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is N-benzyl-3-[[(2-naphthalen-2-ylacetyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[[(2-naphthalen-2-ylacetyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27690215 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-benzyl-3-[[(2-naphthalen-2-ylacetyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)NNC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C26H23N3O4S/c30-25(16-20-13-14-21-9-4-5-10-22(21)15-20)28-29-26(31)23-11-6-12-24(17-23)34(32,33)27-18-19-7-2-1-3-8-19/h1-15,17,27H,16,18H2,(H,28,30)(H,29,31) |
| InChIKey | SOJHJFNSYNNMPR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|