C24H24N4O6S — CID 51510456
3-[[[2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]carbamoyl]-N-benzylbenzenesulfonamide (PubChem CID 51510456) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is 3-[[[2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]carbamoyl]-N-benzylbenzenesulfonamide.
| Compound Name | 3-[[[2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]carbamoyl]-N-benzylbenzenesulfonamide |
|---|---|
| PubChem CID | 51510456 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 3-[[[2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]carbamoyl]-N-benzylbenzenesulfonamide |
| SMILES | O=C(CN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)NNC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N4O6S/c29-21(15-28-23(31)19-11-4-5-12-20(19)24(28)32)26-27-22(30)17-9-6-10-18(13-17)35(33,34)25-14-16-7-2-1-3-8-16/h1-10,13,19-20,25H,11-12,14-15H2,(H,26,29)(H,27,30)/t19-,20-/m1/s1 |
| InChIKey | QMILUXZCBNHKBI-WOJBJXKFSA-N |
| XLogP | 0.88 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|