C25H25N3O5S — CID 4790967
N-benzyl-3-[[[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 4790967) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is N-benzyl-3-[[[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[[[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4790967 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-benzyl-3-[[[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | O=C(COc1ccc2c(c1)CCC2)NNC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C25H25N3O5S/c29-24(17-33-22-13-12-19-8-4-9-20(19)14-22)27-28-25(30)21-10-5-11-23(15-21)34(31,32)26-16-18-6-2-1-3-7-18/h1-3,5-7,10-15,26H,4,8-9,16-17H2,(H,27,29)(H,28,30) |
| InChIKey | IAHNIPUEILGLDB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|