C19H20N2O3 — CID 9220922
N'-[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]-2-methylbenzohydrazide (PubChem CID 9220922) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N'-[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]-2-methylbenzohydrazide.
| Compound Name | N'-[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 9220922 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N'-[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)COc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H20N2O3/c1-13-5-2-3-8-17(13)19(23)21-20-18(22)12-24-16-10-9-14-6-4-7-15(14)11-16/h2-3,5,8-11H,4,6-7,12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | CKKVRYGGENAQDX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|