C21H24N2O3S — CID 55374410
N'-[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetyl]-2-(3,4-dimethylphenoxy)acetohydrazide (PubChem CID 55374410) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N'-[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetyl]-2-(3,4-dimethylphenoxy)acetohydrazide.
| Compound Name | N'-[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetyl]-2-(3,4-dimethylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 55374410 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N'-[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetyl]-2-(3,4-dimethylphenoxy)acetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)CSc2ccc3c(c2)CCC3)cc1C |
| InChI | InChI=1S/C21H24N2O3S/c1-14-6-8-18(10-15(14)2)26-12-20(24)22-23-21(25)13-27-19-9-7-16-4-3-5-17(16)11-19/h6-11H,3-5,12-13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | CPADTXYRGGDJPW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|