C15H21NOS — CID 60652410
N-butan-2-yl-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetamide (PubChem CID 60652410) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is N-butan-2-yl-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetamide.
| Compound Name | N-butan-2-yl-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 60652410 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-butan-2-yl-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetamide |
| SMILES | CCC(C)NC(=O)CSc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H21NOS/c1-3-11(2)16-15(17)10-18-14-8-7-12-5-4-6-13(12)9-14/h7-9,11H,3-6,10H2,1-2H3,(H,16,17) |
| InChIKey | CIJCMRPAYKJPHD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |