C11H11O2S- — CID 7128917
2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetate (PubChem CID 7128917) has the molecular formula C11H11O2S- and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetate.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 7128917 |
| Molecular Formula | C11H11O2S- |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetate |
| SMILES | O=C([O-])CSc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C11H12O2S/c12-11(13)7-14-10-5-4-8-2-1-3-9(8)6-10/h4-6H,1-3,7H2,(H,12,13)/p-1 |
| InChIKey | RUVTVWNOODRTNI-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |