C17H17NOS — CID 26644664
2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-phenylacetamide (PubChem CID 26644664) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-phenylacetamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 26644664 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-phenylacetamide |
| SMILES | O=C(CSc1ccc2c(c1)CCC2)Nc1ccccc1 |
| InChI | InChI=1S/C17H17NOS/c19-17(18-15-7-2-1-3-8-15)12-20-16-10-9-13-5-4-6-14(13)11-16/h1-3,7-11H,4-6,12H2,(H,18,19) |
| InChIKey | RMQRSHJLOJHIGA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |