C16H24N2O3S — CID 78771822
N'-(2-tert-butylsulfanylacetyl)-2-(3,4-dimethylphenoxy)acetohydrazide (PubChem CID 78771822) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is N'-(2-tert-butylsulfanylacetyl)-2-(3,4-dimethylphenoxy)acetohydrazide.
| Compound Name | N'-(2-tert-butylsulfanylacetyl)-2-(3,4-dimethylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 78771822 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N'-(2-tert-butylsulfanylacetyl)-2-(3,4-dimethylphenoxy)acetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)CSC(C)(C)C)cc1C |
| InChI | InChI=1S/C16H24N2O3S/c1-11-6-7-13(8-12(11)2)21-9-14(19)17-18-15(20)10-22-16(3,4)5/h6-8H,9-10H2,1-5H3,(H,17,19)(H,18,20) |
| InChIKey | RHAAPNVKQAIOIB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|