C16H17Cl2N3O3 — CID 55676601
4,5-dichloro-N'-[2-(3,4-dimethylphenoxy)acetyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 55676601) has the molecular formula C16H17Cl2N3O3 and a molecular weight of 370.24 g/mol. Its IUPAC name is 4,5-dichloro-N'-[2-(3,4-dimethylphenoxy)acetyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4,5-dichloro-N'-[2-(3,4-dimethylphenoxy)acetyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 55676601 |
| Molecular Formula | C16H17Cl2N3O3 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 4,5-dichloro-N'-[2-(3,4-dimethylphenoxy)acetyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)c2cc(Cl)c(Cl)n2C)cc1C |
| InChI | InChI=1S/C16H17Cl2N3O3/c1-9-4-5-11(6-10(9)2)24-8-14(22)19-20-16(23)13-7-12(17)15(18)21(13)3/h4-7H,8H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | SKGBYIFMBOGWNW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|