C17H16ClFN2O3 — CID 27569390
2-chloro-N'-[2-(3,4-dimethylphenoxy)acetyl]-4-fluorobenzohydrazide (PubChem CID 27569390) has the molecular formula C17H16ClFN2O3 and a molecular weight of 350.78 g/mol. Its IUPAC name is 2-chloro-N'-[2-(3,4-dimethylphenoxy)acetyl]-4-fluorobenzohydrazide.
| Compound Name | 2-chloro-N'-[2-(3,4-dimethylphenoxy)acetyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 27569390 |
| Molecular Formula | C17H16ClFN2O3 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-chloro-N'-[2-(3,4-dimethylphenoxy)acetyl]-4-fluorobenzohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)c2ccc(F)cc2Cl)cc1C |
| InChI | InChI=1S/C17H16ClFN2O3/c1-10-3-5-13(7-11(10)2)24-9-16(22)20-21-17(23)14-6-4-12(19)8-15(14)18/h3-8H,9H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | RFIRADFOQMYSIL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|