C24H31N3O4 — CID 55944327
4-tert-butyl-N-[(2S)-1-[2-[2-(3,4-dimethylphenoxy)acetyl]hydrazinyl]-1-oxopropan-2-yl]benzamide (PubChem CID 55944327) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2S)-1-[2-[2-(3,4-dimethylphenoxy)acetyl]hydrazinyl]-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[(2S)-1-[2-[2-(3,4-dimethylphenoxy)acetyl]hydrazinyl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 55944327 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4-tert-butyl-N-[(2S)-1-[2-[2-(3,4-dimethylphenoxy)acetyl]hydrazinyl]-1-oxopropan-2-yl]benzamide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)[C@H](C)NC(=O)c2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C24H31N3O4/c1-15-7-12-20(13-16(15)2)31-14-21(28)26-27-22(29)17(3)25-23(30)18-8-10-19(11-9-18)24(4,5)6/h7-13,17H,14H2,1-6H3,(H,25,30)(H,26,28)(H,27,29)/t17-/m0/s1 |
| InChIKey | HYUABKSRTSHFOK-KRWDZBQOSA-N |
| XLogP | 2.95 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|