C20H21F3N2O3 — CID 55545672
N-[2-[[2-(3,4-dimethylphenoxy)acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 55545672) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[2-[[2-(3,4-dimethylphenoxy)acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[2-(3,4-dimethylphenoxy)acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55545672 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[2-[[2-(3,4-dimethylphenoxy)acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(OCC(=O)NCCNC(=O)c2ccc(C(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C20H21F3N2O3/c1-13-3-8-17(11-14(13)2)28-12-18(26)24-9-10-25-19(27)15-4-6-16(7-5-15)20(21,22)23/h3-8,11H,9-10,12H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | ONHJMPYPLJXASK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|