C19H18F3N3O4 — CID 55917606
3-[2-oxo-2-[2-[[4-(trifluoromethyl)benzoyl]amino]ethylamino]ethoxy]benzamide (PubChem CID 55917606) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is 3-[2-oxo-2-[2-[[4-(trifluoromethyl)benzoyl]amino]ethylamino]ethoxy]benzamide.
| Compound Name | 3-[2-oxo-2-[2-[[4-(trifluoromethyl)benzoyl]amino]ethylamino]ethoxy]benzamide |
|---|---|
| PubChem CID | 55917606 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 3-[2-oxo-2-[2-[[4-(trifluoromethyl)benzoyl]amino]ethylamino]ethoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCC(=O)NCCNC(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H18F3N3O4/c20-19(21,22)14-6-4-12(5-7-14)18(28)25-9-8-24-16(26)11-29-15-3-1-2-13(10-15)17(23)27/h1-7,10H,8-9,11H2,(H2,23,27)(H,24,26)(H,25,28) |
| InChIKey | NXQNFBODPCYJRL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|