C16H24N2O4 — CID 87024121
3-[2-[2-(3-methylbutoxy)ethylamino]-2-oxoethoxy]benzamide (PubChem CID 87024121) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-[2-[2-(3-methylbutoxy)ethylamino]-2-oxoethoxy]benzamide.
| Compound Name | 3-[2-[2-(3-methylbutoxy)ethylamino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 87024121 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-[2-[2-(3-methylbutoxy)ethylamino]-2-oxoethoxy]benzamide |
| SMILES | CC(C)CCOCCNC(=O)COc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-12(2)6-8-21-9-7-18-15(19)11-22-14-5-3-4-13(10-14)16(17)20/h3-5,10,12H,6-9,11H2,1-2H3,(H2,17,20)(H,18,19) |
| InChIKey | QDPOIENZRQGWHX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|