C27H38N2O4 — CID 17169454
N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-(3,4-dimethylphenoxy)propanehydrazide (PubChem CID 17169454) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-(3,4-dimethylphenoxy)propanehydrazide.
| Compound Name | N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-(3,4-dimethylphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 17169454 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-(3,4-dimethylphenoxy)propanehydrazide |
| SMILES | Cc1ccc(OC(C)C(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)cc1C |
| InChI | InChI=1S/C27H38N2O4/c1-17-10-12-21(14-18(17)2)33-19(3)25(31)29-28-24(30)16-32-23-13-11-20(26(4,5)6)15-22(23)27(7,8)9/h10-15,19H,16H2,1-9H3,(H,28,30)(H,29,31) |
| InChIKey | TVMVBVZGNKUVAW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|