C21H24BrN3O6 — CID 4951428
N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-(4-nitrophenoxy)propanehydrazide (PubChem CID 4951428) has the molecular formula C21H24BrN3O6 and a molecular weight of 494.34 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-(4-nitrophenoxy)propanehydrazide.
| Compound Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-(4-nitrophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 4951428 |
| Molecular Formula | C21H24BrN3O6 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-(4-nitrophenoxy)propanehydrazide |
| SMILES | CC(Oc1ccc([N+](=O)[O-])cc1)C(=O)NNC(=O)COc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C21H24BrN3O6/c1-13(31-16-8-6-15(7-9-16)25(28)29)20(27)24-23-19(26)12-30-18-10-5-14(11-17(18)22)21(2,3)4/h5-11,13H,12H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | XQHQBPMJSLLMOH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|