C14H19N3O6 — CID 17357947
N'-(3-ethoxypropanoyl)-2-(4-nitrophenoxy)propanehydrazide (PubChem CID 17357947) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is N'-(3-ethoxypropanoyl)-2-(4-nitrophenoxy)propanehydrazide.
| Compound Name | N'-(3-ethoxypropanoyl)-2-(4-nitrophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 17357947 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N'-(3-ethoxypropanoyl)-2-(4-nitrophenoxy)propanehydrazide |
| SMILES | CCOCCC(=O)NNC(=O)C(C)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H19N3O6/c1-3-22-9-8-13(18)15-16-14(19)10(2)23-12-6-4-11(5-7-12)17(20)21/h4-7,10H,3,8-9H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | MMNQAFUEASMLMC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|