C21H23N3O8 — CID 4951438
propyl 4-[2-[2-[2-(4-nitrophenoxy)propanoyl]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 4951438) has the molecular formula C21H23N3O8 and a molecular weight of 445.43 g/mol. Its IUPAC name is propyl 4-[2-[2-[2-(4-nitrophenoxy)propanoyl]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | propyl 4-[2-[2-[2-(4-nitrophenoxy)propanoyl]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 4951438 |
| Molecular Formula | C21H23N3O8 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | propyl 4-[2-[2-[2-(4-nitrophenoxy)propanoyl]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCCOC(=O)c1ccc(OCC(=O)NNC(=O)C(C)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H23N3O8/c1-3-12-30-21(27)15-4-8-17(9-5-15)31-13-19(25)22-23-20(26)14(2)32-18-10-6-16(7-11-18)24(28)29/h4-11,14H,3,12-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | QOGNFANZWCIJQF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|