C25H32N2O6 — CID 17130058
propyl 4-[2-[2-[2-(2-butan-2-ylphenoxy)propanoyl]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 17130058) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is propyl 4-[2-[2-[2-(2-butan-2-ylphenoxy)propanoyl]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | propyl 4-[2-[2-[2-(2-butan-2-ylphenoxy)propanoyl]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 17130058 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | propyl 4-[2-[2-[2-(2-butan-2-ylphenoxy)propanoyl]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCCOC(=O)c1ccc(OCC(=O)NNC(=O)C(C)Oc2ccccc2C(C)CC)cc1 |
| InChI | InChI=1S/C25H32N2O6/c1-5-15-31-25(30)19-11-13-20(14-12-19)32-16-23(28)26-27-24(29)18(4)33-22-10-8-7-9-21(22)17(3)6-2/h7-14,17-18H,5-6,15-16H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | LFSGDPHJGKUXKO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|