C18H18ClN3O6 — CID 8960583
2-chloro-N'-[(2S)-2-(4-ethoxyphenoxy)propanoyl]-4-nitrobenzohydrazide (PubChem CID 8960583) has the molecular formula C18H18ClN3O6 and a molecular weight of 407.81 g/mol. Its IUPAC name is 2-chloro-N'-[(2S)-2-(4-ethoxyphenoxy)propanoyl]-4-nitrobenzohydrazide.
| Compound Name | 2-chloro-N'-[(2S)-2-(4-ethoxyphenoxy)propanoyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 8960583 |
| Molecular Formula | C18H18ClN3O6 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-chloro-N'-[(2S)-2-(4-ethoxyphenoxy)propanoyl]-4-nitrobenzohydrazide |
| SMILES | CCOc1ccc(O[C@@H](C)C(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O6/c1-3-27-13-5-7-14(8-6-13)28-11(2)17(23)20-21-18(24)15-9-4-12(22(25)26)10-16(15)19/h4-11H,3H2,1-2H3,(H,20,23)(H,21,24)/t11-/m0/s1 |
| InChIKey | PXFWEVNMUJPHPZ-NSHDSACASA-N |
| XLogP | 2.88 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|