C22H28N2O6 — CID 43003826
3,4-diethoxy-N'-[2-(4-ethoxyphenoxy)propanoyl]benzohydrazide (PubChem CID 43003826) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 3,4-diethoxy-N'-[2-(4-ethoxyphenoxy)propanoyl]benzohydrazide.
| Compound Name | 3,4-diethoxy-N'-[2-(4-ethoxyphenoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 43003826 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3,4-diethoxy-N'-[2-(4-ethoxyphenoxy)propanoyl]benzohydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)c2ccc(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C22H28N2O6/c1-5-27-17-9-11-18(12-10-17)30-15(4)21(25)23-24-22(26)16-8-13-19(28-6-2)20(14-16)29-7-3/h8-15H,5-7H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | ZSSQKQILVKQTLR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|