C19H23N3O6S — CID 52522344
[3-[[[(2S)-2-(4-ethoxyphenoxy)propanoyl]amino]carbamoyl]phenyl]methanesulfonamide (PubChem CID 52522344) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is [3-[[[(2S)-2-(4-ethoxyphenoxy)propanoyl]amino]carbamoyl]phenyl]methanesulfonamide.
| Compound Name | [3-[[[(2S)-2-(4-ethoxyphenoxy)propanoyl]amino]carbamoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 52522344 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [3-[[[(2S)-2-(4-ethoxyphenoxy)propanoyl]amino]carbamoyl]phenyl]methanesulfonamide |
| SMILES | CCOc1ccc(O[C@@H](C)C(=O)NNC(=O)c2cccc(CS(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C19H23N3O6S/c1-3-27-16-7-9-17(10-8-16)28-13(2)18(23)21-22-19(24)15-6-4-5-14(11-15)12-29(20,25)26/h4-11,13H,3,12H2,1-2H3,(H,21,23)(H,22,24)(H2,20,25,26)/t13-/m0/s1 |
| InChIKey | CKHGYCKHYAGOTN-ZDUSSCGKSA-N |
| XLogP | 1.10 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|