C22H28FN3O6S — CID 55343944
5-[[2-(4-ethoxyphenoxy)propanoylamino]carbamoyl]-N,N-diethyl-2-fluorobenzenesulfonamide (PubChem CID 55343944) has the molecular formula C22H28FN3O6S and a molecular weight of 481.55 g/mol. Its IUPAC name is 5-[[2-(4-ethoxyphenoxy)propanoylamino]carbamoyl]-N,N-diethyl-2-fluorobenzenesulfonamide.
| Compound Name | 5-[[2-(4-ethoxyphenoxy)propanoylamino]carbamoyl]-N,N-diethyl-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 55343944 |
| Molecular Formula | C22H28FN3O6S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 5-[[2-(4-ethoxyphenoxy)propanoylamino]carbamoyl]-N,N-diethyl-2-fluorobenzenesulfonamide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)c2ccc(F)c(S(=O)(=O)N(CC)CC)c2)cc1 |
| InChI | InChI=1S/C22H28FN3O6S/c1-5-26(6-2)33(29,30)20-14-16(8-13-19(20)23)22(28)25-24-21(27)15(4)32-18-11-9-17(10-12-18)31-7-3/h8-15H,5-7H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | QGUARUOGAOMJOL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|