C19H19BrN4O7 — CID 4922335
N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-3,5-dinitrobenzohydrazide (PubChem CID 4922335) has the molecular formula C19H19BrN4O7 and a molecular weight of 495.29 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-3,5-dinitrobenzohydrazide.
| Compound Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 4922335 |
| Molecular Formula | C19H19BrN4O7 |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-3,5-dinitrobenzohydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C19H19BrN4O7/c1-19(2,3)12-4-5-16(15(20)8-12)31-10-17(25)21-22-18(26)11-6-13(23(27)28)9-14(7-11)24(29)30/h4-9H,10H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | YGQUXNSFAXGUAZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|