C21H16BrN3O5 — CID 4960799
N'-[2-(2-bromo-4-phenylphenoxy)acetyl]-4-nitrobenzohydrazide (PubChem CID 4960799) has the molecular formula C21H16BrN3O5 and a molecular weight of 470.28 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-phenylphenoxy)acetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-(2-bromo-4-phenylphenoxy)acetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4960799 |
| Molecular Formula | C21H16BrN3O5 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | N'-[2-(2-bromo-4-phenylphenoxy)acetyl]-4-nitrobenzohydrazide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1Br)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16BrN3O5/c22-18-12-16(14-4-2-1-3-5-14)8-11-19(18)30-13-20(26)23-24-21(27)15-6-9-17(10-7-15)25(28)29/h1-12H,13H2,(H,23,26)(H,24,27) |
| InChIKey | IAJLYYWHEWFQBR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|