C18H18BrN3O7 — CID 17356663
3-bromo-4-(2-methoxyethoxy)-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide (PubChem CID 17356663) has the molecular formula C18H18BrN3O7 and a molecular weight of 468.26 g/mol. Its IUPAC name is 3-bromo-4-(2-methoxyethoxy)-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide.
| Compound Name | 3-bromo-4-(2-methoxyethoxy)-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 17356663 |
| Molecular Formula | C18H18BrN3O7 |
| Molecular Weight | 468.26 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 3-bromo-4-(2-methoxyethoxy)-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide |
| SMILES | COCCOc1ccc(C(=O)NNC(=O)COc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C18H18BrN3O7/c1-27-8-9-28-16-7-2-12(10-15(16)19)18(24)21-20-17(23)11-29-14-5-3-13(4-6-14)22(25)26/h2-7,10H,8-9,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | IUQGTGXBEUQKBF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|