C21H22BrN3O5 — CID 17176125
(E)-N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-3-(3-nitrophenyl)prop-2-enehydrazide (PubChem CID 17176125) has the molecular formula C21H22BrN3O5 and a molecular weight of 476.33 g/mol. Its IUPAC name is (E)-N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-3-(3-nitrophenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-3-(3-nitrophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 17176125 |
| Molecular Formula | C21H22BrN3O5 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | (E)-N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-3-(3-nitrophenyl)prop-2-enehydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)/C=C/c2cccc([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C21H22BrN3O5/c1-21(2,3)15-8-9-18(17(22)12-15)30-13-20(27)24-23-19(26)10-7-14-5-4-6-16(11-14)25(28)29/h4-12H,13H2,1-3H3,(H,23,26)(H,24,27)/b10-7+ |
| InChIKey | GTXRXCRGLJAOAN-JXMROGBWSA-N |
| XLogP | 3.89 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|