C18H17N3O6 — CID 7943372
(E)-N'-[2-(2-methoxyphenoxy)acetyl]-3-(3-nitrophenyl)prop-2-enehydrazide (PubChem CID 7943372) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is (E)-N'-[2-(2-methoxyphenoxy)acetyl]-3-(3-nitrophenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2-methoxyphenoxy)acetyl]-3-(3-nitrophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 7943372 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (E)-N'-[2-(2-methoxyphenoxy)acetyl]-3-(3-nitrophenyl)prop-2-enehydrazide |
| SMILES | COc1ccccc1OCC(=O)NNC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17N3O6/c1-26-15-7-2-3-8-16(15)27-12-18(23)20-19-17(22)10-9-13-5-4-6-14(11-13)21(24)25/h2-11H,12H2,1H3,(H,19,22)(H,20,23)/b10-9+ |
| InChIKey | OONKWPRRCKHLNB-MDZDMXLPSA-N |
| XLogP | 1.84 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|