C17H14IN3O5 — CID 17176085
3-iodo-4-methoxy-N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]benzohydrazide (PubChem CID 17176085) has the molecular formula C17H14IN3O5 and a molecular weight of 467.22 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | 3-iodo-4-methoxy-N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 17176085 |
| Molecular Formula | C17H14IN3O5 |
| Molecular Weight | 467.22 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 3-iodo-4-methoxy-N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)/C=C/c2cccc([N+](=O)[O-])c2)cc1I |
| InChI | InChI=1S/C17H14IN3O5/c1-26-15-7-6-12(10-14(15)18)17(23)20-19-16(22)8-5-11-3-2-4-13(9-11)21(24)25/h2-10H,1H3,(H,19,22)(H,20,23)/b8-5+ |
| InChIKey | OWBPALUIFCITEC-VMPITWQZSA-N |
| XLogP | 2.68 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|