C23H19N3O5 — CID 6182233
(E)-3-(4-nitrophenyl)-N'-[2-(2-phenylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 6182233) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N'-[2-(2-phenylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(4-nitrophenyl)-N'-[2-(2-phenylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 6182233 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N'-[2-(2-phenylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H19N3O5/c27-22(15-12-17-10-13-19(14-11-17)26(29)30)24-25-23(28)16-31-21-9-5-4-8-20(21)18-6-2-1-3-7-18/h1-15H,16H2,(H,24,27)(H,25,28)/b15-12+ |
| InChIKey | PARCPCFDSWKKNE-NTCAYCPXSA-N |
| XLogP | 3.50 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|