C23H20N2O3 — CID 5088874
3-phenyl-N'-[2-(2-phenylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 5088874) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-phenyl-N'-[2-(2-phenylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | 3-phenyl-N'-[2-(2-phenylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 5088874 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-phenyl-N'-[2-(2-phenylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | O=C(C=Cc1ccccc1)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3/c26-22(16-15-18-9-3-1-4-10-18)24-25-23(27)17-28-21-14-8-7-13-20(21)19-11-5-2-6-12-19/h1-16H,17H2,(H,24,26)(H,25,27) |
| InChIKey | UZZABTFWNHZZTL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|