C36H30N4O6 — CID 3554709
1-N',4-N'-bis[2-(2-phenylphenoxy)acetyl]benzene-1,4-dicarbohydrazide (PubChem CID 3554709) has the molecular formula C36H30N4O6 and a molecular weight of 614.66 g/mol. Its IUPAC name is 1-N',4-N'-bis[2-(2-phenylphenoxy)acetyl]benzene-1,4-dicarbohydrazide.
| Compound Name | 1-N',4-N'-bis[2-(2-phenylphenoxy)acetyl]benzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 3554709 |
| Molecular Formula | C36H30N4O6 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 1-N',4-N'-bis[2-(2-phenylphenoxy)acetyl]benzene-1,4-dicarbohydrazide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC(=O)c1ccc(C(=O)NNC(=O)COc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30N4O6/c41-33(23-45-31-17-9-7-15-29(31)25-11-3-1-4-12-25)37-39-35(43)27-19-21-28(22-20-27)36(44)40-38-34(42)24-46-32-18-10-8-16-30(32)26-13-5-2-6-14-26/h1-22H,23-24H2,(H,37,41)(H,38,42)(H,39,43)(H,40,44) |
| InChIKey | HDEASQMXSKJZNU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|