C23H21BrN2O5 — CID 27568544
4-bromo-3,5-dimethoxy-N'-[2-(2-phenylphenoxy)acetyl]benzohydrazide (PubChem CID 27568544) has the molecular formula C23H21BrN2O5 and a molecular weight of 485.33 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N'-[2-(2-phenylphenoxy)acetyl]benzohydrazide.
| Compound Name | 4-bromo-3,5-dimethoxy-N'-[2-(2-phenylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 27568544 |
| Molecular Formula | C23H21BrN2O5 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N'-[2-(2-phenylphenoxy)acetyl]benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)COc2ccccc2-c2ccccc2)cc(OC)c1Br |
| InChI | InChI=1S/C23H21BrN2O5/c1-29-19-12-16(13-20(30-2)22(19)24)23(28)26-25-21(27)14-31-18-11-7-6-10-17(18)15-8-4-3-5-9-15/h3-13H,14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ASVFURMPAFMVTG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|