C25H25N3O6S — CID 55377531
N-cyclopropyl-2-methoxy-5-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 55377531) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is N-cyclopropyl-2-methoxy-5-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-2-methoxy-5-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55377531 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-cyclopropyl-2-methoxy-5-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | COc1ccc(C(=O)NNC(=O)COc2ccccc2-c2ccccc2)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C25H25N3O6S/c1-33-22-14-11-18(15-23(22)35(31,32)28-19-12-13-19)25(30)27-26-24(29)16-34-21-10-6-5-9-20(21)17-7-3-2-4-8-17/h2-11,14-15,19,28H,12-13,16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | MUAXTZUNLNDJSE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|