C15H20N2O6S — CID 119223228
2-[[3-(cyclopropylsulfamoyl)-4-methoxybenzoyl]amino]butanoic acid (PubChem CID 119223228) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[[3-(cyclopropylsulfamoyl)-4-methoxybenzoyl]amino]butanoic acid.
| Compound Name | 2-[[3-(cyclopropylsulfamoyl)-4-methoxybenzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119223228 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[[3-(cyclopropylsulfamoyl)-4-methoxybenzoyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)c1ccc(OC)c(S(=O)(=O)NC2CC2)c1)C(=O)O |
| InChI | InChI=1S/C15H20N2O6S/c1-3-11(15(19)20)16-14(18)9-4-7-12(23-2)13(8-9)24(21,22)17-10-5-6-10/h4,7-8,10-11,17H,3,5-6H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | BADYXUXGTFMXEP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |