C14H21N3O4S — CID 119502368
3-(cyclopropylsulfamoyl)-4-methoxy-N-[2-(methylamino)ethyl]benzamide (PubChem CID 119502368) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-4-methoxy-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-4-methoxy-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 119502368 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-4-methoxy-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1ccc(OC)c(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C14H21N3O4S/c1-15-7-8-16-14(18)10-3-6-12(21-2)13(9-10)22(19,20)17-11-4-5-11/h3,6,9,11,15,17H,4-5,7-8H2,1-2H3,(H,16,18) |
| InChIKey | ZODDGHXINVEKRF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|